|
|
|
|
|
Indomethacin |
|
indomethacinmethanolsolution |
|
53-86-1 |
|
Usage: The anti-inflammatory, antipyretic effect, mainly used for salicylic acid drugs not easily tolerated or effect is not significant rheumatic and arthritis, ankylosing spondylitis, light bone arthritis
|
|
Assay: 98.5%-100.5% Package: 25kg / drum Appearance: White or light yellow crystalline powder¡¡ CAS NO:53-86-1 EINECS: 200-186-5 MF: C19H15ClNO4 InChI:InChI=1/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23)/p-1 MW: 356.7802 ¡¡¡¡ melting point: 155-162¡É Boiling point: 499.4¡ÆC at 760 mmHg
|
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|