|
|
|
|
|
Indacaterol |
|
5-[2-(5,6-Diethyl-2,3-dihydro-1H-inden-2-ylamino)-(1R)-hydroxyethyl]-8-hydroxyquinolin-2(1H)-one |
|
312753-06-3 |
|
Indacaterol is an ultra-long-acting beta-adrenoceptor agonist. It is licensed only for the treatment of chronic obstructive pulmonary disease (COPD) (long-term data in patients with asthma are thus far lacking). |
|
Grade Standard: Tech Grade Purity: 99% Molecular Formula: C24H28N2O3 Molecular Weight: 392.4907 Inchi: InChI=1/C24H28N2O3/c1-3-14-9-16-11-18(12-17(16)10-15(14)4-2)25-13-22(28)19-5-7-21(27)24-20(19)6-8-23(29)26-24/h5-10,18,22,25,27-28H,3-4,11-13H2,1-2H3,(H,26,29) Density: 1.27g/cm3 Boiling point: 660.3¡ÆC at 760 mmHg Refractive index: 1.659 Flash point: 353.1¡ÆC Vapour Pressur: 2.47E-18mmHg at 25¡ÆC
|
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|