|
|
|
|
|
Econazole Nitrate |
|
1-[2-[(4-Chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)-ethyl]-1H-imidazole mononitrate |
|
27220-47-9 |
|
Usage: The first generation of imidazole antibacterial drugs. This product for antifungal drugs, on Candida albicans in castor, coccidioidomycosis, Cryptococcus neoformans, Histoplasma capsulatum, Blastomyces dermatitidis and ringworm and other effective
|
|
Assay: 99% Package: 25kg / drum Appearance: White or light yellow crystalline powder¡¡ CAS#: 27220-47-9 MF:C18H15Cl3N2O.HNO3I InChI:InChI=1/C18H15Cl3N2O.H2NO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21 2-1(3)4/h1-9,12,18H,10-11H2 (H2,2,3,4)/q +1 MW: 381.68 ¡¡¡¡ melting point: 86.8¡É |
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|