 |
 |
|
|
|
| Biotin |
 |
| Vitamin H |
 |
| 58-85-5 |
 |
Usage: Mainly used for biotin deficiency, can also be used for seborrheic dermatitis and infant and urinary erythroderma, atrophic glossitis, hypersensitivity, muscle aches, fatigue, anorexia and mild anemia
|
 |
Assay: 99%
Package: 25kg / drum
Appearance: Colorless needle-like crystals
CAS#:58-85-5
No. EINECS: 200-399-3
MF: C10H16N2O3S
InChI:InChI=1/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/p-1/t6-,7-,9+/m0/s1
MW: 244.3032
melting point: 232-233℃
|
|
|
|
|
|
