|
|
|
|
|
Octyl Palmitate |
|
CH3(CH2)14COOCH2CH(C2H5)(CH2)3CH3 |
|
29806-73-3 |
|
Test Specification Appearance White to pale yellow oily liquid Color(APHA) ¡Â50 Ester content ¡Ã98.0% Special gravity (25oC) 0.850~0.862 Refractive index (25oC) 1.443~1.447 Acid number,mgKOH/g ¡Â1.0 Saponification value,mgKOH/g 150-154
|
|
octyl palmitate can be dissolved with organic solvents, insoluble in water.
The octyl palmitate usually was used as emollient, solubilizer, bond, brightener, antisticking agent, lubricant, suspension agent, and anti-jam agent for bath products, skin care products, deodorizers, chemical compounds, lamination processing, lubrication, metal processing, antirust agents, textiles, leathers and ointments.
The volumes of usage in cream or lotion are 2- 5%.
|
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|