화학DB 개요  |  화학제품[Product]  |  화학물질[Chemical]  |  화학업체[Company]
Hydroxypropyl-beta-Cyclodextrin
Hydroxypropyl-beta-Cyclodextrin

Pharmaceutical Use
Hydroxypropyl-beta-Cyclodextrin

Other name: HP-β-CD
1.Appearance: Hydroxypropyl-beta-Cyclodextrin is white powder, sweet, insipid innocent and can be used in both medicine field and food field.
2.Molecular formula: C42H70-XO35(CH2CHOH-CH3)X

3.Molecular weght:1135+58X

4.CAS No.:128446-35-5

5.Spec: 99%

6.Store: Cool and dry, avoid light, avoid high temperature place

7.Packaging:1kg/bag 10kg/barrel,or customized.

Application in different fields:
Pharmaceutical:
1. To increase the solubility of medicine and biological availability
2. To improve the bioavailability of drugs
3. To adjust or control the releasing of drugs.
4. To decrease the toxicities of drugs.
5. To improve the stabilities of drugs.

Cosmetic:
1. To suit for encapsulation of volatile compounds.
2. To increase shelf life of expensive flavours.

Food:
1.To prevent evaporation of volatile substances.
2.To get rid of the terrible smell.
3.To significantly enhance the effects of emulsification.
4.To make preservative of food release slowly.
제품관련분야 의약,중간체
Shenzhen Shijingu Technology Co., Ltd
전화번호 86-755-61930356
팩스번호 86-755-84556470
홈페이지 http://shijingu.en.made-in-china.com
이메일 ycgl03@yccreate.com
주소 CambridgeGarden,Longgang District
이제품에 대해 등록된 판매업체가 없습니다.