|
|
|
|
|
Polysucrose Dormacoll (CAS No.:26873-85-8) |
|
Polysucrose Dormacoll (CAS No.:26873-85-8) |
|
pharmaceutical intermediate, mainly used for separation of a variety of cells, including blood cells, fibroblasts, tumor cells, rat liver cells |
|
Polysucrose Dormacoll (CAS No.:26873-85-8)
CAS Number:26873-85-8 Formula:(C12H22O11)n.(C3H5ClO)n Synonyms: Ficoll 400 See R-D-Glucopyranoside,a-D-fructofuranosyl,polymers,polymer with (chloromethyl)oxirane Dormacoll
Assay:99% Appearance:white powder Packing: 25kg/drum Application: pharmaceutical intermediate, mainly used for separation of a variety of cells, including blood cells, fibroblasts, tumor cells, rat liver cells |
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|