|
|
|
|
|
chlorphenamine hydrogen maleate |
|
Odorless white crystalline solid or white powder with a bitter taste |
|
113-92-8 |
|
Antihistaminic |
|
chlorphenamine hydrogen maleate
Name: chlorphenamine hydrogen maleate EINECS:204-037-5 Molecular Formula:C20H23ClN2O4 CAS :113-92-8 Synonyms:CHLORPHENIRAMINE MALEATE Chloropheniramine maleate InChI:InChI=1/C16H19ClN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13 5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3 1-2H,(H,5,6)(H,7,8)/b 2-1+
Appearance:Odorless white crystalline solid or white powder with a bitter taste.Package:25KG/DRUM Standard:enterprise standard Assay:99% Molecular Weight:390.86 Density:1.107 g/cm3 Boiling Point:379 oC at 760 mmHg Melting Point:130-135¡É Flash Point:183 oC
Storage Temperature:Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. Solubility:1-5 g/100 mL at 21 oC
Usage:Antihistaminic |
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|