|
|
|
|
|
fluoroalkylsilane |
|
* |
|
fluoroalkylsilane used as surface modifier for hydrophobic/oleophobic
degussa (degussa ¢ç) organosilane Dynasylan¢ç Product (functional group) Ingredients Chemical formula SG (25¡ÆC) BP ¡ÆC FP ¡ÆC Applied polymer Packing (kg) Recommend F-8261 tridecafluoroocty ltriethoxysilane F3C-(CF2)5-(CH2)2-Si(OC2H5)3 1.33 220 85 used as surface modifier for hydrophobic/oleophobic . material of sol -gel, fluorosilicone resin, pigment surface modified (cosmetics ) 25 F-8815 aqueous modified fluoroalkylsiloxane - 1.058 97 >61 used as surface modifierfor hydrophobic/oleophobic. material of sol -gel, fluorosilicone resin, pigment surface modified (cosmetics ), dehydrate agent of leather and textile , improve oil removing capacity 25
|
|
* |
Á¦Ç°°ü·ÃºÐ¾ß |
¿°·á,¾È·á, ÆäÀÎÆ®,À×Å© |
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|