|
|
|
|
|
Silane Coupling Agent KH-560 |
|
3-glycidoxypropyltrimethoxysilane. |
|
2530-83-8 |
|
The use of the product 1) KH-560 is used in epoxy adhesives and polysulfide sealants. It improves adhesion. 2) KH-560 is used in glass fiber to reinforce epoxy resin. It can improve the physical properties, especially the wet strength of the composite. 3) KH-560 is used in mineral filled composites. These composites are aluminum hydroxide, silica, mica, wollastonite, and pearls of glass. 4) KH-560 should be stored in closed containers in a day place. The shelf life is not less than half year. |
|
1.The corresponding foreign trademark A-187 (UCC, America), Z-6040 (Dow Corring, America), KBM-403 (Japan)
2.Chemical designation 3-glycidoxypropyltrimethoxysilane.
3.Chemical structural formula CH2-CH-CH2-OCH2CH2CH2SI(OCH3)3 \ / 0
4.Property This product is a transparent liquid, which is colorless. It can dissolve in benzene, acetone, carbon tetrachloride, which cannot dissolve in water. Boiling point at 760mmHg:290¡É,Apparent Specific Gravity 25/25¡É,1.069,Refractive Index/25¡É,1.427,Flash point,110¡É. |
Á¦Ç°°ü·ÃºÐ¾ß |
¹«±âÈÇÕ¹°, À¯±â ½Ç¸®ÄÜ, ±âŸ |
|
|
|
|
|
|
|
ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆǸž÷ü°¡ ¾ø½À´Ï´Ù. |
|
|
|
|
|