 |
 |
|
|
|
| 4-Chlorocinnamic acid |
 |
| 4-Chlorocinnamic acid |
 |
4-Chlorocinnamic acid
|
 |
product Name 4-Chlorocinnamic acid
Synonyms (2E)-3-(4-chlorophenyl)prop-2-enoic acid 4-Chlorophenyl acrylic acid
Molecular Formula C9H7ClO2
Molecular Weight 182.61
InChI InChI=1/C9H7ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/b6-3+
CAS Registry Number 1615-02-7
EINECS 216-564-8
Molecular Structure
Melting point 246-250¡É
Appearance:white crystal powder,it can be solved in ethanol, ethyl acetate and other organic solvent.
Usage£ºIt can be used for organic synthesize intermediate
Assay :99%
Packing: 25kg net/bag or box.
Brand: Nanjian
|
|
|
|
 |
|
|
|
|
|
 |
| ÀÌÁ¦Ç°¿¡ ´ëÇØ µî·ÏµÈ ÆÇ¸Å¾÷ü°¡ ¾ø½À´Ï´Ù. |
|
 |
|
|
|